
Acta Cryst. (2008). E64, m722-m723 [ doi:10.1107/S1600536808011112 ]
O)tin(IV)The Sn atom in the title compound, [Sn(C5H9)(C6H5)2(C6H10N3O2S)], exists within a tetrahedral geometry. The -NH2 group forms a weak hydrogen bond across a center of inversion to the S atom of an adjacent molecule, as well as another weaker hydrogen (across another center of inversion) to the Sn-bound O atom of another molecule. The hydrogen-bonded layer structure is consolidated by a strong hydrogen bond between the -NH- group and the uncoordinated O atom of a third molecule.
Levulinic acid thiosemicarbazone was synthesized from the reaction of levulinic acid and thiosemicarbazide (Ng, 1992). Cyclopentyldiphenyltin hydroxide was sythesized by using a multistep reaction, starting from the Grignard reaction of cyclopentylmagnesium bromide on triphenyltin chloride. One phenyl radical was then cleaved by iodine in DMF; the resulting iodide was then hydrolyzed with sodium hydroxide in acetone to give the mixed triorganotin hydroxide (Lo et al., 1999). The thiosemicarbazone (1.1 g, 5 mmol) and triorganotin hydroxide (2 g, 5 mmol) were dissolved in hot ethanol (50 ml). The clear solution was filtered and colorless crystals separated from the cool solution after a day (yield: 75%).
Carbon-bound H-atoms were placed in calculated positions (C—H 0.95 to 0.99 Å) and were included in the refinement in the riding model approximation, with U(H) set to 1.2 to 1.5U(C). The nitrogen-bound H-atom were similarly generated (N–H 0.88±0.01 Å) and their temperature factors similarly tied.
The final difference Fourier map had a large peak at 1.4 Å from C1 but was otherwise diffuse.
Data collection: APEX2 (Bruker, 2007); cell refinement: SAINT (Bruker, 2007); data reduction: SAINT (Bruker, 2007); program(s) used to solve structure: SHELXS97 (Sheldrick, 2008); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008); molecular graphics: X-SEED (Barbour, 2001); software used to prepare material for publication: publCIF (Westrip, 2008).
| Fig. 1. 70% Probability thermal ellipsoid plot of Sn(C5H9)(C6H5)2(C12H15N3O2S), (I), show atom-numbering scheme. Hydrogen atoms are drawn as spheres of arbitrary radius. |
| [Sn(C5H9)(C6H5)2(C6H10N3O2S)] | Z = 2 |
| Mr = 530.24 | F000 = 540 |
| Triclinic, P1 | Dx = 1.503 Mg m−3 |
| Hall symbol: -P 1 | Mo Kα radiation λ = 0.71073 Å |
| a = 9.5780 (1) Å | Cell parameters from 9905 reflections |
| b = 10.2375 (1) Å | θ = 2.4–28.3º |
| c = 13.4205 (1) Å | µ = 1.20 mm−1 |
| α = 86.901 (1)º | T = 100 (2) K |
| β = 83.370 (1)º | Irregular block, colorless |
| γ = 63.667 (1)º | 0.30 × 0.15 × 0.10 mm |
| V = 1171.50 (2) Å3 |
| Bruker SMART APEXII diffractometer | 5350 independent reflections |
| Radiation source: fine-focus sealed tube | 5186 reflections with I > 2σ(I) |
| Monochromator: graphite | Rint = 0.014 |
| T = 100(2) K | θmax = 27.5º |
| ω scans | θmin = 1.5º |
| Absorption correction: multi-scan (SADABS; Sheldrick, 1996) | h = −9→12 |
| Tmin = 0.779, Tmax = 0.889 | k = −13→13 |
| 15020 measured reflections | l = −17→17 |
| Refinement on F2 | Secondary atom site location: difference Fourier map |
| Least-squares matrix: full | Hydrogen site location: inferred from neighbouring sites |
| R[F2 > 2σ(F2)] = 0.028 | H-atom parameters constrained |
| wR(F2) = 0.078 | w = 1/[σ2(Fo2) + (0.0431P)2 + 2.3757P] where P = (Fo2 + 2Fc2)/3 |
| S = 1.03 | (Δ/σ)max < 0.001 |
| 5350 reflections | Δρmax = 1.99 e Å−3 |
| 272 parameters | Δρmin = −0.91 e Å−3 |
| Primary atom site location: structure-invariant direct methods | Extinction correction: none |
| [Sn(C5H9)(C6H5)2(C6H10N3O2S)] | γ = 63.667 (1)º |
| Mr = 530.24 | V = 1171.50 (2) Å3 |
| Triclinic, P1 | Z = 2 |
| a = 9.5780 (1) Å | Mo Kα |
| b = 10.2375 (1) Å | µ = 1.20 mm−1 |
| c = 13.4205 (1) Å | T = 100 (2) K |
| α = 86.901 (1)º | 0.30 × 0.15 × 0.10 mm |
| β = 83.370 (1)º |
| Bruker SMART APEXII diffractometer | 5350 independent reflections |
| Absorption correction: multi-scan (SADABS; Sheldrick, 1996) | 5186 reflections with I > 2σ(I) |
| Tmin = 0.779, Tmax = 0.889 | Rint = 0.014 |
| 15020 measured reflections |
| R[F2 > 2σ(F2)] = 0.028 | 272 parameters |
| wR(F2) = 0.078 | H-atom parameters constrained |
| S = 1.03 | Δρmax = 1.99 e Å−3 |
| 5350 reflections | Δρmin = −0.91 e Å−3 |
| x | y | z | Uiso*/Ueq | ||
| Sn1 | 0.400900 (17) | 0.628156 (16) | 0.232609 (11) | 0.01648 (6) | |
| S1 | 0.24404 (7) | 0.05406 (6) | 0.56139 (5) | 0.02291 (13) | |
| O1 | 0.4075 (2) | 0.63541 (19) | 0.38521 (13) | 0.0191 (3) | |
| O2 | 0.1648 (2) | 0.66366 (19) | 0.38475 (13) | 0.0188 (3) | |
| N1 | 0.1747 (2) | 0.4584 (2) | 0.57946 (15) | 0.0161 (4) | |
| N2 | 0.1483 (2) | 0.3354 (2) | 0.58783 (15) | 0.0160 (4) | |
| H2N | 0.0552 | 0.3410 | 0.6087 | 0.019* | |
| N3 | 0.4100 (2) | 0.2066 (2) | 0.54086 (17) | 0.0215 (4) | |
| H3N1 | 0.4187 | 0.2883 | 0.5433 | 0.026* | |
| H3N2 | 0.4933 | 0.1248 | 0.5240 | 0.026* | |
| C1 | 0.2123 (3) | 0.8151 (3) | 0.1783 (2) | 0.0269 (5) | |
| H1 | 0.1189 | 0.7944 | 0.1863 | 0.032* | |
| C2 | 0.2415 (5) | 0.8439 (5) | 0.0673 (3) | 0.0712 (16) | |
| H2A | 0.1932 | 0.8001 | 0.0267 | 0.085* | |
| H2B | 0.3553 | 0.8010 | 0.0460 | 0.085* | |
| C3 | 0.1675 (4) | 1.0097 (4) | 0.0531 (2) | 0.0359 (7) | |
| H3A | 0.2491 | 1.0442 | 0.0376 | 0.043* | |
| H3B | 0.0987 | 1.0397 | −0.0019 | 0.043* | |
| C4 | 0.0732 (5) | 1.0696 (4) | 0.1530 (3) | 0.0495 (9) | |
| H4A | −0.0343 | 1.0788 | 0.1542 | 0.059* | |
| H4B | 0.0672 | 1.1663 | 0.1663 | 0.059* | |
| C5 | 0.1651 (4) | 0.9556 (3) | 0.2307 (3) | 0.0398 (7) | |
| H5A | 0.2577 | 0.9674 | 0.2456 | 0.048* | |
| H5B | 0.0978 | 0.9625 | 0.2940 | 0.048* | |
| C6 | 0.4168 (3) | 0.4221 (3) | 0.19650 (18) | 0.0199 (5) | |
| C7 | 0.4926 (3) | 0.2975 (3) | 0.2541 (2) | 0.0245 (5) | |
| H7 | 0.5361 | 0.3044 | 0.3126 | 0.029* | |
| C8 | 0.5049 (3) | 0.1635 (3) | 0.2263 (2) | 0.0285 (6) | |
| H8 | 0.5560 | 0.0794 | 0.2661 | 0.034* | |
| C9 | 0.4429 (3) | 0.1523 (3) | 0.1411 (2) | 0.0271 (5) | |
| H9 | 0.4516 | 0.0607 | 0.1223 | 0.032* | |
| C10 | 0.3684 (3) | 0.2743 (3) | 0.08321 (19) | 0.0238 (5) | |
| H10 | 0.3244 | 0.2668 | 0.0251 | 0.029* | |
| C11 | 0.3575 (3) | 0.4079 (3) | 0.10956 (19) | 0.0225 (5) | |
| H11 | 0.3093 | 0.4906 | 0.0680 | 0.027* | |
| C12 | 0.6217 (3) | 0.6303 (3) | 0.19063 (17) | 0.0176 (4) | |
| C13 | 0.7494 (3) | 0.5069 (3) | 0.14887 (18) | 0.0201 (5) | |
| H13 | 0.7382 | 0.4206 | 0.1403 | 0.024* | |
| C14 | 0.8925 (3) | 0.5089 (3) | 0.11974 (19) | 0.0236 (5) | |
| H14 | 0.9784 | 0.4245 | 0.0913 | 0.028* | |
| C15 | 0.9095 (3) | 0.6343 (3) | 0.13229 (19) | 0.0243 (5) | |
| H15 | 1.0070 | 0.6359 | 0.1118 | 0.029* | |
| C16 | 0.7847 (3) | 0.7577 (3) | 0.17470 (19) | 0.0231 (5) | |
| H16 | 0.7970 | 0.8432 | 0.1841 | 0.028* | |
| C17 | 0.6419 (3) | 0.7553 (3) | 0.20323 (18) | 0.0198 (5) | |
| H17 | 0.5565 | 0.8400 | 0.2318 | 0.024* | |
| C18 | 0.2692 (3) | 0.6595 (2) | 0.43182 (18) | 0.0163 (4) | |
| C19 | 0.2537 (3) | 0.6844 (3) | 0.54288 (18) | 0.0184 (4) | |
| H19A | 0.2739 | 0.7692 | 0.5536 | 0.022* | |
| H19B | 0.3354 | 0.5982 | 0.5733 | 0.022* | |
| C20 | 0.0950 (3) | 0.7117 (3) | 0.59732 (18) | 0.0194 (5) | |
| H20A | 0.0866 | 0.7515 | 0.6645 | 0.023* | |
| H20B | 0.0126 | 0.7872 | 0.5600 | 0.023* | |
| C21 | 0.0628 (3) | 0.5805 (2) | 0.61014 (17) | 0.0162 (4) | |
| C22 | −0.0961 (3) | 0.6051 (3) | 0.65817 (19) | 0.0211 (5) | |
| H22A | −0.1493 | 0.7023 | 0.6884 | 0.032* | |
| H22B | −0.0851 | 0.5313 | 0.7103 | 0.032* | |
| H22C | −0.1579 | 0.5979 | 0.6073 | 0.032* | |
| C23 | 0.2715 (3) | 0.2065 (2) | 0.56254 (17) | 0.0170 (4) |
| U11 | U22 | U33 | U12 | U13 | U23 | |
| Sn1 | 0.01453 (9) | 0.01349 (9) | 0.02213 (10) | −0.00650 (6) | −0.00357 (6) | 0.00085 (6) |
| S1 | 0.0168 (3) | 0.0119 (3) | 0.0404 (4) | −0.0064 (2) | −0.0043 (2) | 0.0007 (2) |
| O1 | 0.0150 (8) | 0.0209 (8) | 0.0235 (8) | −0.0098 (7) | −0.0020 (6) | −0.0008 (6) |
| O2 | 0.0167 (8) | 0.0197 (8) | 0.0223 (8) | −0.0099 (7) | −0.0036 (6) | 0.0004 (6) |
| N1 | 0.0180 (9) | 0.0135 (9) | 0.0185 (9) | −0.0081 (8) | −0.0033 (7) | −0.0001 (7) |
| N2 | 0.0139 (9) | 0.0128 (9) | 0.0219 (9) | −0.0065 (7) | −0.0021 (7) | 0.0007 (7) |
| N3 | 0.0148 (9) | 0.0140 (9) | 0.0349 (11) | −0.0058 (8) | 0.0000 (8) | −0.0047 (8) |
| C1 | 0.0213 (12) | 0.0260 (13) | 0.0251 (12) | −0.0028 (10) | −0.0042 (10) | 0.0019 (10) |
| C2 | 0.046 (2) | 0.068 (3) | 0.040 (2) | 0.023 (2) | 0.0084 (16) | 0.0231 (19) |
| C3 | 0.0378 (16) | 0.0442 (18) | 0.0334 (15) | −0.0241 (14) | −0.0144 (12) | 0.0166 (13) |
| C4 | 0.049 (2) | 0.0292 (16) | 0.064 (2) | −0.0123 (15) | −0.0080 (18) | 0.0046 (15) |
| C5 | 0.0435 (18) | 0.0289 (15) | 0.0423 (17) | −0.0111 (14) | −0.0067 (14) | 0.0004 (13) |
| C6 | 0.0214 (11) | 0.0190 (11) | 0.0228 (11) | −0.0120 (10) | −0.0032 (9) | 0.0000 (9) |
| C7 | 0.0274 (13) | 0.0209 (12) | 0.0287 (13) | −0.0120 (10) | −0.0120 (10) | 0.0026 (10) |
| C8 | 0.0327 (14) | 0.0183 (12) | 0.0366 (14) | −0.0120 (11) | −0.0105 (11) | 0.0048 (10) |
| C9 | 0.0285 (14) | 0.0221 (12) | 0.0323 (14) | −0.0124 (11) | −0.0035 (11) | −0.0021 (10) |
| C10 | 0.0257 (13) | 0.0257 (13) | 0.0224 (12) | −0.0133 (11) | −0.0020 (10) | −0.0032 (9) |
| C11 | 0.0236 (12) | 0.0205 (12) | 0.0230 (12) | −0.0091 (10) | −0.0052 (9) | 0.0021 (9) |
| C12 | 0.0163 (11) | 0.0177 (11) | 0.0186 (10) | −0.0072 (9) | −0.0035 (8) | 0.0027 (8) |
| C13 | 0.0215 (12) | 0.0169 (11) | 0.0209 (11) | −0.0075 (9) | −0.0030 (9) | 0.0021 (9) |
| C14 | 0.0188 (12) | 0.0238 (12) | 0.0227 (12) | −0.0050 (10) | −0.0008 (9) | 0.0009 (9) |
| C15 | 0.0200 (12) | 0.0322 (14) | 0.0232 (12) | −0.0144 (11) | −0.0020 (9) | 0.0040 (10) |
| C16 | 0.0265 (13) | 0.0260 (12) | 0.0233 (12) | −0.0171 (11) | −0.0041 (10) | 0.0015 (9) |
| C17 | 0.0194 (11) | 0.0185 (11) | 0.0211 (11) | −0.0079 (9) | −0.0026 (9) | −0.0003 (9) |
| C18 | 0.0165 (11) | 0.0098 (9) | 0.0234 (11) | −0.0063 (8) | −0.0023 (8) | −0.0002 (8) |
| C19 | 0.0206 (11) | 0.0142 (10) | 0.0228 (11) | −0.0095 (9) | −0.0038 (9) | −0.0014 (8) |
| C20 | 0.0202 (11) | 0.0143 (10) | 0.0226 (11) | −0.0064 (9) | −0.0013 (9) | −0.0029 (8) |
| C21 | 0.0163 (11) | 0.0157 (10) | 0.0162 (10) | −0.0063 (9) | −0.0033 (8) | −0.0009 (8) |
| C22 | 0.0172 (11) | 0.0209 (11) | 0.0234 (11) | −0.0070 (9) | −0.0006 (9) | −0.0032 (9) |
| C23 | 0.0173 (11) | 0.0139 (10) | 0.0203 (11) | −0.0068 (9) | −0.0050 (8) | 0.0006 (8) |
| Sn1—O1 | 2.063 (2) | C7—H7 | 0.9500 |
| Sn1—C1 | 2.131 (3) | C8—C9 | 1.379 (4) |
| Sn1—C6 | 2.125 (2) | C8—H8 | 0.9500 |
| Sn1—C12 | 2.134 (2) | C9—C10 | 1.380 (4) |
| S1—C23 | 1.695 (2) | C9—H9 | 0.9500 |
| O1—C18 | 1.320 (3) | C10—C11 | 1.387 (4) |
| O2—C18 | 1.227 (3) | C10—H10 | 0.9500 |
| N1—C21 | 1.283 (3) | C11—H11 | 0.9500 |
| N1—N2 | 1.387 (3) | C12—C13 | 1.398 (3) |
| N2—C23 | 1.350 (3) | C12—C17 | 1.399 (3) |
| N2—H2N | 0.8800 | C13—C14 | 1.391 (4) |
| N3—C23 | 1.325 (3) | C13—H13 | 0.9500 |
| N3—H3N1 | 0.8800 | C14—C15 | 1.384 (4) |
| N3—H3N2 | 0.8800 | C14—H14 | 0.9500 |
| C1—C5 | 1.492 (4) | C15—C16 | 1.389 (4) |
| C1—C2 | 1.522 (4) | C15—H15 | 0.9500 |
| C1—H1 | 1.0000 | C16—C17 | 1.388 (4) |
| C2—C3 | 1.532 (5) | C16—H16 | 0.9500 |
| C2—H2A | 0.9900 | C17—H17 | 0.9500 |
| C2—H2B | 0.9900 | C18—C19 | 1.505 (3) |
| C3—C4 | 1.519 (5) | C19—C20 | 1.520 (3) |
| C3—H3A | 0.9900 | C19—H19A | 0.9900 |
| C3—H3B | 0.9900 | C19—H19B | 0.9900 |
| C4—C5 | 1.547 (5) | C20—C21 | 1.503 (3) |
| C4—H4A | 0.9900 | C20—H20A | 0.9900 |
| C4—H4B | 0.9900 | C20—H20B | 0.9900 |
| C5—H5A | 0.9900 | C21—C22 | 1.499 (3) |
| C5—H5B | 0.9900 | C22—H22A | 0.9800 |
| C6—C11 | 1.396 (3) | C22—H22B | 0.9800 |
| C6—C7 | 1.398 (3) | C22—H22C | 0.9800 |
| C7—C8 | 1.393 (4) | ||
| O1—Sn1—C1 | 112.7 (1) | C8—C9—H9 | 120.0 |
| O1—Sn1—C6 | 108.6 (1) | C10—C9—H9 | 120.0 |
| O1—Sn1—C12 | 95.9 (1) | C9—C10—C11 | 120.2 (2) |
| C1—Sn1—C6 | 116.5 (1) | C9—C10—H10 | 119.9 |
| C1—Sn1—C12 | 112.1 (1) | C11—C10—H10 | 119.9 |
| C6—Sn1—C12 | 109.2 (1) | C10—C11—C6 | 120.7 (2) |
| Sn1—O1—C18 | 109.3 (1) | C10—C11—H11 | 119.7 |
| C21—N1—N2 | 118.3 (2) | C6—C11—H11 | 119.7 |
| C23—N2—N1 | 117.11 (19) | C13—C12—C17 | 118.4 (2) |
| C23—N2—H2N | 121.4 | C13—C12—Sn1 | 120.71 (18) |
| N1—N2—H2N | 121.4 | C17—C12—Sn1 | 120.94 (18) |
| C23—N3—H3N1 | 120.0 | C14—C13—C12 | 120.8 (2) |
| C23—N3—H3N2 | 120.0 | C14—C13—H13 | 119.6 |
| H3N1—N3—H3N2 | 120.0 | C12—C13—H13 | 119.6 |
| C5—C1—C2 | 106.2 (3) | C15—C14—C13 | 119.9 (2) |
| C5—C1—Sn1 | 116.7 (2) | C15—C14—H14 | 120.1 |
| C2—C1—Sn1 | 113.0 (2) | C13—C14—H14 | 120.1 |
| C5—C1—H1 | 106.8 | C14—C15—C16 | 120.4 (2) |
| C2—C1—H1 | 106.8 | C14—C15—H15 | 119.8 |
| Sn1—C1—H1 | 106.8 | C16—C15—H15 | 119.8 |
| C1—C2—C3 | 106.9 (3) | C17—C16—C15 | 119.5 (2) |
| C1—C2—H2A | 110.3 | C17—C16—H16 | 120.2 |
| C3—C2—H2A | 110.3 | C15—C16—H16 | 120.2 |
| C1—C2—H2B | 110.3 | C16—C17—C12 | 121.1 (2) |
| C3—C2—H2B | 110.3 | C16—C17—H17 | 119.5 |
| H2A—C2—H2B | 108.6 | C12—C17—H17 | 119.5 |
| C4—C3—C2 | 104.5 (3) | O2—C18—O1 | 120.5 (2) |
| C4—C3—H3A | 110.9 | O2—C18—C19 | 125.2 (2) |
| C2—C3—H3A | 110.9 | O1—C18—C19 | 114.2 (2) |
| C4—C3—H3B | 110.9 | C18—C19—C20 | 114.6 (2) |
| C2—C3—H3B | 110.9 | C18—C19—H19A | 108.6 |
| H3A—C3—H3B | 108.9 | C20—C19—H19A | 108.6 |
| C3—C4—C5 | 104.1 (3) | C18—C19—H19B | 108.6 |
| C3—C4—H4A | 110.9 | C20—C19—H19B | 108.6 |
| C5—C4—H4A | 110.9 | H19A—C19—H19B | 107.6 |
| C3—C4—H4B | 110.9 | C21—C20—C19 | 115.40 (19) |
| C5—C4—H4B | 110.9 | C21—C20—H20A | 108.4 |
| H4A—C4—H4B | 109.0 | C19—C20—H20A | 108.4 |
| C1—C5—C4 | 102.4 (3) | C21—C20—H20B | 108.4 |
| C1—C5—H5A | 111.3 | C19—C20—H20B | 108.4 |
| C4—C5—H5A | 111.3 | H20A—C20—H20B | 107.5 |
| C1—C5—H5B | 111.3 | N1—C21—C22 | 126.5 (2) |
| C4—C5—H5B | 111.3 | N1—C21—C20 | 116.6 (2) |
| H5A—C5—H5B | 109.2 | C22—C21—C20 | 116.8 (2) |
| C11—C6—C7 | 118.4 (2) | C21—C22—H22A | 109.5 |
| C11—C6—Sn1 | 119.38 (18) | C21—C22—H22B | 109.5 |
| C7—C6—Sn1 | 122.09 (18) | H22A—C22—H22B | 109.5 |
| C8—C7—C6 | 120.4 (2) | C21—C22—H22C | 109.5 |
| C8—C7—H7 | 119.8 | H22A—C22—H22C | 109.5 |
| C6—C7—H7 | 119.8 | H22B—C22—H22C | 109.5 |
| C9—C8—C7 | 120.2 (3) | N3—C23—N2 | 117.2 (2) |
| C9—C8—H8 | 119.9 | N3—C23—S1 | 123.29 (18) |
| C7—C8—H8 | 119.9 | N2—C23—S1 | 119.54 (18) |
| C8—C9—C10 | 120.0 (2) | ||
| C6—Sn1—O1—C18 | −77.70 (16) | C9—C10—C11—C6 | −2.2 (4) |
| C1—Sn1—O1—C18 | 52.80 (17) | C7—C6—C11—C10 | 2.5 (4) |
| C12—Sn1—O1—C18 | 169.72 (15) | Sn1—C6—C11—C10 | 179.0 (2) |
| C21—N1—N2—C23 | −174.8 (2) | O1—Sn1—C12—C13 | 110.54 (19) |
| O1—Sn1—C1—C5 | 32.7 (3) | C6—Sn1—C12—C13 | −1.5 (2) |
| C6—Sn1—C1—C5 | 159.1 (2) | C1—Sn1—C12—C13 | −132.09 (19) |
| C12—Sn1—C1—C5 | −74.2 (2) | O1—Sn1—C12—C17 | −70.09 (19) |
| O1—Sn1—C1—C2 | 156.3 (3) | C6—Sn1—C12—C17 | 177.87 (18) |
| C6—Sn1—C1—C2 | −77.3 (3) | C1—Sn1—C12—C17 | 47.3 (2) |
| C12—Sn1—C1—C2 | 49.4 (3) | C17—C12—C13—C14 | −0.6 (4) |
| C5—C1—C2—C3 | −15.5 (4) | Sn1—C12—C13—C14 | 178.79 (18) |
| Sn1—C1—C2—C3 | −144.7 (3) | C12—C13—C14—C15 | 0.2 (4) |
| C1—C2—C3—C4 | −9.9 (5) | C13—C14—C15—C16 | 0.6 (4) |
| C2—C3—C4—C5 | 30.7 (4) | C14—C15—C16—C17 | −0.9 (4) |
| C2—C1—C5—C4 | 34.0 (4) | C15—C16—C17—C12 | 0.4 (4) |
| Sn1—C1—C5—C4 | 161.0 (2) | C13—C12—C17—C16 | 0.3 (4) |
| C3—C4—C5—C1 | −40.3 (4) | Sn1—C12—C17—C16 | −179.07 (18) |
| O1—Sn1—C6—C11 | 155.98 (19) | Sn1—O1—C18—O2 | 5.1 (3) |
| C1—Sn1—C6—C11 | 27.6 (2) | Sn1—O1—C18—C19 | −173.25 (14) |
| C12—Sn1—C6—C11 | −100.6 (2) | O2—C18—C19—C20 | 2.0 (3) |
| O1—Sn1—C6—C7 | −27.7 (2) | O1—C18—C19—C20 | −179.78 (19) |
| C1—Sn1—C6—C7 | −156.1 (2) | C18—C19—C20—C21 | 72.7 (3) |
| C12—Sn1—C6—C7 | 75.7 (2) | N2—N1—C21—C22 | 2.0 (3) |
| C11—C6—C7—C8 | −1.6 (4) | N2—N1—C21—C20 | −178.51 (19) |
| Sn1—C6—C7—C8 | −178.0 (2) | C19—C20—C21—N1 | 3.9 (3) |
| C6—C7—C8—C9 | 0.4 (4) | C19—C20—C21—C22 | −176.6 (2) |
| C7—C8—C9—C10 | −0.1 (4) | N1—N2—C23—N3 | 6.1 (3) |
| C8—C9—C10—C11 | 1.0 (4) | N1—N2—C23—S1 | −174.76 (16) |
| D—H···A | D—H | H···A | D···A | D—H···A |
| N2—H2n···O2i | 0.88 | 2.12 | 2.975 (3) | 163 |
| N3—H3n1···O1ii | 0.88 | 2.43 | 3.121 (3) | 136 |
| N3—H3n2···S1iii | 0.88 | 2.54 | 3.389 (2) | 161 |
| Symmetry codes: (i) −x, −y+1, −z+1; (ii) −x+1, −y+1, −z+1; (iii) −x+1, −y, −z+1. |
| Sn1—O1 | 2.063 (2) | Sn1—C6 | 2.125 (2) |
| Sn1—C1 | 2.131 (3) | Sn1—C12 | 2.134 (2) |
| O1—Sn1—C1 | 112.7 (1) | C1—Sn1—C12 | 112.1 (1) |
| O1—Sn1—C6 | 108.6 (1) | C6—Sn1—C12 | 109.2 (1) |
| O1—Sn1—C12 | 95.9 (1) | Sn1—O1—C18 | 109.3 (1) |
| C1—Sn1—C6 | 116.5 (1) |
| D—H···A | D—H | H···A | D···A | D—H···A |
| N2—H2n···O2i | 0.88 | 2.12 | 2.975 (3) | 163 |
| N3—H3n1···O1ii | 0.88 | 2.43 | 3.121 (3) | 136 |
| N3—H3n2···S1iii | 0.88 | 2.54 | 3.389 (2) | 161 |
| Symmetry codes: (i) −x, −y+1, −z+1; (ii) −x+1, −y+1, −z+1; (iii) −x+1, −y, −z+1. |
We thank the University of Malaya for funding this study (FR155/2007 A) and also for the purchase of the diffractometer.
Barbour, L. J. (2001). J. Supramol. Chem. 1, 189–191.
Bruker (2007). APEX2 and SAINT. Bruker AXS Inc., Madison, Wisconsin, USA.
Koshy, J., Ansary, A., Lo, K. M. & Kumar Das, V. G. (2001). Met.-Based Drugs, 8, 107–111.
Lo, K. M., Kumar Das, V. G. & Ng, S. W. (1999). Acta Cryst. C55, 889–894.
Lo, K. M. & Ng, S. W. (2004). Acta Cryst. E60, m715–m716.
Ng, S. W. (1992). Acta Cryst. C48, 2057–2058.
Sheldrick, G. M. (1996). SADABS. University of Göttingen, Germany.
Sheldrick, G. M. (2008). Acta Cryst. A64, 112–122.
Teo, Y. Y., Lo, K. M. & Ng, S. W. (2004). Acta Cryst. E60, m1478–m1480.
Tiekink, E. R. T. (1991). Appl. Organomet. Chem. 5, 1–23.
Tiekink, E. R. T. (1994). Trends Organomet. Chem. 1, 71–116.
Westrip, S. P. (2008). publCIF. In preparation.
Triorganotin carboxylates having two different organyl substituents possess ehanced anti-bacterial and anti-fungal properties compared with the symmetrical compounds (Koshy et al., 2001). The synthesis of cyclopentyldiphenyltin hydroxide, which is the principal reagent that condenses readily with carboxylic acids, is a multi-step synthesis. Previous studies have characterized a few cyclopentyldiphenyltin derivatives (Lo & Ng, 2004; Lo et al., 1999; Teo et al., 2004). In the reaction with levulinic acid thiosemicarbazone (Ng, 1992), the organotin hydroxide yields a four-coordinate compound (I) (Fig. 1 & Table 1). The tin atom exists in a tetrahedral geometry; adjacent molecules are linked by hydrogen bonds into a layer structure, Table 2.